C27H24N2O3 — CID 174344465
methyl (2S)-2-[methyl-(2-phenylquinoline-4-carbonyl)amino]-2-phenylpropanoate (PubChem CID 174344465) has the molecular formula C27H24N2O3 and a molecular weight of 424.50 g/mol. Its IUPAC name is methyl (2S)-2-[methyl-(2-phenylquinoline-4-carbonyl)amino]-2-phenylpropanoate.
| Compound Name | methyl (2S)-2-[methyl-(2-phenylquinoline-4-carbonyl)amino]-2-phenylpropanoate |
|---|---|
| PubChem CID | 174344465 |
| Molecular Formula | C27H24N2O3 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | methyl (2S)-2-[methyl-(2-phenylquinoline-4-carbonyl)amino]-2-phenylpropanoate |
| SMILES | COC(=O)[C@](C)(c1ccccc1)N(C)C(=O)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C27H24N2O3/c1-27(26(31)32-3,20-14-8-5-9-15-20)29(2)25(30)22-18-24(19-12-6-4-7-13-19)28-23-17-11-10-16-21(22)23/h4-18H,1-3H3/t27-/m0/s1 |
| InChIKey | QRMSKWNSHXWLTB-MHZLTWQESA-N |
| XLogP | 5.06 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |