About (2,3-dibenzylcyclopenta-2,4-dien-1-yl)methanamine
(2,3-dibenzylcyclopenta-2,4-dien-1-yl)methanamine (PubChem CID 174344768) has the molecular formula C20H21N
and a molecular weight of 275.40 g/mol. Its IUPAC name is (2,3-dibenzylcyclopenta-2,4-dien-1-yl)methanamine.
Molecular Properties
| Compound Name | (2,3-dibenzylcyclopenta-2,4-dien-1-yl)methanamine |
| PubChem CID | 174344768 |
| Molecular Formula | C20H21N |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | (2,3-dibenzylcyclopenta-2,4-dien-1-yl)methanamine |
| SMILES | NCC1C=CC(Cc2ccccc2)=C1Cc1ccccc1 |
| InChI | InChI=1S/C20H21N/c21-15-19-12-11-18(13-16-7-3-1-4-8-16)20(19)14-17-9-5-2-6-10-17/h1-12,19H,13-15,21H2 |
| InChIKey | IVGBJAZHTZDNRV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2,3-dibenzylcyclopenta-2,4-dien-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dibenzylcyclopenta-2,4-dien-1-yl)methanamine?
The IUPAC name of (2,3-dibenzylcyclopenta-2,4-dien-1-yl)methanamine (CID 174344768) is (2,3-dibenzylcyclopenta-2,4-dien-1-yl)methanamine.
What is the SMILES notation for (2,3-dibenzylcyclopenta-2,4-dien-1-yl)methanamine?
The canonical SMILES for (2,3-dibenzylcyclopenta-2,4-dien-1-yl)methanamine is NCC1C=CC(Cc2ccccc2)=C1Cc1ccccc1.
What is the InChIKey of (2,3-dibenzylcyclopenta-2,4-dien-1-yl)methanamine?
The InChIKey is IVGBJAZHTZDNRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N/c21-15-19-12-11-18(13-16-7-3-1-4-8-16)20(19)14-17-9-5-2-6-10-17/h1-12,19H,13-15,21H2.
What are the key properties of (2,3-dibenzylcyclopenta-2,4-dien-1-yl)methanamine?
(2,3-dibenzylcyclopenta-2,4-dien-1-yl)methanamine has a molecular weight of 275.40 g/mol, XLogP of 3.91, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dibenzylcyclopenta-2,4-dien-1-yl)methanamine is sourced from PubChem (CID 174344768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).