C16H16Cl2NNaO2 — CID 174345984
sodium;N,N-dichloro-2-phenylethanamine;2-phenylacetate (PubChem CID 174345984) has the molecular formula C16H16Cl2NNaO2 and a molecular weight of 348.21 g/mol. Its IUPAC name is sodium;N,N-dichloro-2-phenylethanamine;2-phenylacetate.
| Compound Name | sodium;N,N-dichloro-2-phenylethanamine;2-phenylacetate |
|---|---|
| PubChem CID | 174345984 |
| Molecular Formula | C16H16Cl2NNaO2 |
| Molecular Weight | 348.21 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | sodium;N,N-dichloro-2-phenylethanamine;2-phenylacetate |
| SMILES | ClN(Cl)CCc1ccccc1.O=C([O-])Cc1ccccc1.[Na+] |
| InChI | InChI=1S/C8H9Cl2N.C8H8O2.Na/c9-11(10)7-6-8-4-2-1-3-5-8;9-8(10)6-7-4-2-1-3-5-7;/h1-5H,6-7H2;1-5H,6H2,(H,9,10);/q;;+1/p-1 |
| InChIKey | BCMUZDFWJCJCQN-UHFFFAOYSA-M |
| XLogP | -0.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.21 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|