C7H11N2O3Zn- — CID 174347159
4-acetamido-5-oxopentanamide;zinc (PubChem CID 174347159) has the molecular formula C7H11N2O3Zn- and a molecular weight of 236.57 g/mol. Its IUPAC name is 4-acetamido-5-oxopentanamide;zinc.
| Compound Name | 4-acetamido-5-oxopentanamide;zinc |
|---|---|
| PubChem CID | 174347159 |
| Molecular Formula | C7H11N2O3Zn- |
| Molecular Weight | 236.57 g/mol |
| Exact Mass | 235.01 |
| IUPAC Name | 4-acetamido-5-oxopentanamide;zinc |
| SMILES | CC(=O)NC([C-]=O)CCC(N)=O.[Zn] |
| InChI | InChI=1S/C7H11N2O3.Zn/c1-5(11)9-6(4-10)2-3-7(8)12;/h6H,2-3H2,1H3,(H2,8,12)(H,9,11);/q-1; |
| InChIKey | JSNAOHMJNMQVDM-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.57 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|