About 2-hydrazinylideneethyl propanoate
2-hydrazinylideneethyl propanoate (PubChem CID 174347476) has the molecular formula C5H10N2O2
and a molecular weight of 130.15 g/mol. Its IUPAC name is 2-hydrazinylideneethyl propanoate.
Molecular Properties
| Compound Name | 2-hydrazinylideneethyl propanoate |
| PubChem CID | 174347476 |
| Molecular Formula | C5H10N2O2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.07 |
| IUPAC Name | 2-hydrazinylideneethyl propanoate |
| SMILES | CCC(=O)OCC=NN |
| InChI | InChI=1S/C5H10N2O2/c1-2-5(8)9-4-3-7-6/h3H,2,4,6H2,1H3 |
| InChIKey | OQRXTLCPRHDVNL-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydrazinylideneethyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydrazinylideneethyl propanoate?
The IUPAC name of 2-hydrazinylideneethyl propanoate (CID 174347476) is 2-hydrazinylideneethyl propanoate.
What is the SMILES notation for 2-hydrazinylideneethyl propanoate?
The canonical SMILES for 2-hydrazinylideneethyl propanoate is CCC(=O)OCC=NN.
What is the InChIKey of 2-hydrazinylideneethyl propanoate?
The InChIKey is OQRXTLCPRHDVNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O2/c1-2-5(8)9-4-3-7-6/h3H,2,4,6H2,1H3.
What are the key properties of 2-hydrazinylideneethyl propanoate?
2-hydrazinylideneethyl propanoate has a molecular weight of 130.15 g/mol, XLogP of -0.12, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydrazinylideneethyl propanoate is sourced from PubChem (CID 174347476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).