C18H27FN4OS — CID 174352523
3-[3-(dimethylamino)propyl]-2-[3-(dimethylamino)propylsulfanyl]-6-fluoroquinazolin-4-one (PubChem CID 174352523) has the molecular formula C18H27FN4OS and a molecular weight of 366.51 g/mol. Its IUPAC name is 3-[3-(dimethylamino)propyl]-2-[3-(dimethylamino)propylsulfanyl]-6-fluoroquinazolin-4-one.
| Compound Name | 3-[3-(dimethylamino)propyl]-2-[3-(dimethylamino)propylsulfanyl]-6-fluoroquinazolin-4-one |
|---|---|
| PubChem CID | 174352523 |
| Molecular Formula | C18H27FN4OS |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 3-[3-(dimethylamino)propyl]-2-[3-(dimethylamino)propylsulfanyl]-6-fluoroquinazolin-4-one |
| SMILES | CN(C)CCCSc1nc2ccc(F)cc2c(=O)n1CCCN(C)C |
| InChI | InChI=1S/C18H27FN4OS/c1-21(2)9-5-11-23-17(24)15-13-14(19)7-8-16(15)20-18(23)25-12-6-10-22(3)4/h7-8,13H,5-6,9-12H2,1-4H3 |
| InChIKey | QCDCQBPJMIFTOS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|