C20H21BN4O3S — CID 89247124
CID 89247124 (PubChem CID 89247124) has the molecular formula C20H21BN4O3S and a molecular weight of 408.29 g/mol.
| Compound Name | CID 89247124 |
|---|---|
| PubChem CID | 89247124 |
| Molecular Formula | C20H21BN4O3S |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2nc(SCc3ccc([N+](=O)[O-])cc3)n(CCCN(C)C)c(=O)c2c1 |
| InChI | InChI=1S/C20H21BN4O3S/c1-23(2)10-3-11-24-19(26)17-12-15(21)6-9-18(17)22-20(24)29-13-14-4-7-16(8-5-14)25(27)28/h4-9,12H,3,10-11,13H2,1-2H3 |
| InChIKey | FXAGZAYPWVMMBC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|