C25H31BN4OS — CID 89247125
CID 89247125 (PubChem CID 89247125) has the molecular formula C25H31BN4OS and a molecular weight of 446.43 g/mol.
| Compound Name | CID 89247125 |
|---|---|
| PubChem CID | 89247125 |
| Molecular Formula | C25H31BN4OS |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2nc(SCc3cc(C)cc(C)c3)n(CCCN3CCN(C)CC3)c(=O)c2c1 |
| InChI | InChI=1S/C25H31BN4OS/c1-18-13-19(2)15-20(14-18)17-32-25-27-23-6-5-21(26)16-22(23)24(31)30(25)8-4-7-29-11-9-28(3)10-12-29/h5-6,13-16H,4,7-12,17H2,1-3H3 |
| InChIKey | AUSAXHCPQNMBHD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|