C22H39F2N5 — CID 174352529
(1E,3E)-4-(3,3-difluoropyrrolidin-1-yl)-1-N'-[[6-(3,3-dimethylbutyl)-6-azaspiro[2.5]octan-2-yl]methyl]buta-1,3-diene-1,1,4-triamine (PubChem CID 174352529) has the molecular formula C22H39F2N5 and a molecular weight of 411.59 g/mol. Its IUPAC name is (1E,3E)-4-(3,3-difluoropyrrolidin-1-yl)-1-N'-[[6-(3,3-dimethylbutyl)-6-azaspiro[2.5]octan-2-yl]methyl]buta-1,3-diene-1,1,4-triamine.
| Compound Name | (1E,3E)-4-(3,3-difluoropyrrolidin-1-yl)-1-N'-[[6-(3,3-dimethylbutyl)-6-azaspiro[2.5]octan-2-yl]methyl]buta-1,3-diene-1,1,4-triamine |
|---|---|
| PubChem CID | 174352529 |
| Molecular Formula | C22H39F2N5 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.32 |
| IUPAC Name | (1E,3E)-4-(3,3-difluoropyrrolidin-1-yl)-1-N'-[[6-(3,3-dimethylbutyl)-6-azaspiro[2.5]octan-2-yl]methyl]buta-1,3-diene-1,1,4-triamine |
| SMILES | CC(C)(C)CCN1CCC2(CC1)CC2CN/C(N)=C/C=C(\N)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C22H39F2N5/c1-20(2,3)6-10-28-11-7-21(8-12-28)14-17(21)15-27-18(25)4-5-19(26)29-13-9-22(23,24)16-29/h4-5,17,27H,6-16,25-26H2,1-3H3/b18-4+,19-5+ |
| InChIKey | OAHVHQXXLWEXPL-MDTWDURMSA-N |
| XLogP | 3.06 |
| TPSA | 70.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|