C7H5BrF3NO — CID 174352734
4-bromo-N,N,3-trifluoro-2-methoxyaniline (PubChem CID 174352734) has the molecular formula C7H5BrF3NO and a molecular weight of 256.02 g/mol. Its IUPAC name is 4-bromo-N,N,3-trifluoro-2-methoxyaniline.
| Compound Name | 4-bromo-N,N,3-trifluoro-2-methoxyaniline |
|---|---|
| PubChem CID | 174352734 |
| Molecular Formula | C7H5BrF3NO |
| Molecular Weight | 256.02 g/mol |
| Exact Mass | 254.95 |
| IUPAC Name | 4-bromo-N,N,3-trifluoro-2-methoxyaniline |
| SMILES | COc1c(N(F)F)ccc(Br)c1F |
| InChI | InChI=1S/C7H5BrF3NO/c1-13-7-5(12(10)11)3-2-4(8)6(7)9/h2-3H,1H3 |
| InChIKey | YVLCAHQBETXDKV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.02 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|