C16H19N7O — CID 174352859
4-[3-[4-(hydroxymethyl)-3,5,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrrolidin-1-yl]butanenitrile (PubChem CID 174352859) has the molecular formula C16H19N7O and a molecular weight of 325.38 g/mol. Its IUPAC name is 4-[3-[4-(hydroxymethyl)-3,5,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrrolidin-1-yl]butanenitrile.
| Compound Name | 4-[3-[4-(hydroxymethyl)-3,5,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrrolidin-1-yl]butanenitrile |
|---|---|
| PubChem CID | 174352859 |
| Molecular Formula | C16H19N7O |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 4-[3-[4-(hydroxymethyl)-3,5,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrrolidin-1-yl]butanenitrile |
| SMILES | N#CCCCN1CCC(n2c(CO)nc3cnc4[nH]ncc4c32)C1 |
| InChI | InChI=1S/C16H19N7O/c17-4-1-2-5-22-6-3-11(9-22)23-14(10-24)20-13-8-18-16-12(15(13)23)7-19-21-16/h7-8,11,24H,1-3,5-6,9-10H2,(H,18,19,21) |
| InChIKey | XKHCGICLYCSSSA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 106.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|