C6H13O5P — CID 174354035
3-(oxiran-2-ylmethoxy)propyl dihydrogen phosphite (PubChem CID 174354035) has the molecular formula C6H13O5P and a molecular weight of 196.14 g/mol. Its IUPAC name is 3-(oxiran-2-ylmethoxy)propyl dihydrogen phosphite.
| Compound Name | 3-(oxiran-2-ylmethoxy)propyl dihydrogen phosphite |
|---|---|
| PubChem CID | 174354035 |
| Molecular Formula | C6H13O5P |
| Molecular Weight | 196.14 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 3-(oxiran-2-ylmethoxy)propyl dihydrogen phosphite |
| SMILES | OP(O)OCCCOCC1CO1 |
| InChI | InChI=1S/C6H13O5P/c7-12(8)11-3-1-2-9-4-6-5-10-6/h6-8H,1-5H2 |
| InChIKey | QAGSSWSGZMCZFI-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.14 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|