C30H26F3N7O — CID 174354761
(2S)-2-(2,4-difluorophenyl)-1-[[2-(4-fluorophenyl)-3-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]pyrazolo[1,5-a]pyridin-7-yl]amino]-3-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 174354761) has the molecular formula C30H26F3N7O and a molecular weight of 557.58 g/mol. Its IUPAC name is (2S)-2-(2,4-difluorophenyl)-1-[[2-(4-fluorophenyl)-3-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]pyrazolo[1,5-a]pyridin-7-yl]amino]-3-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | (2S)-2-(2,4-difluorophenyl)-1-[[2-(4-fluorophenyl)-3-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]pyrazolo[1,5-a]pyridin-7-yl]amino]-3-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 174354761 |
| Molecular Formula | C30H26F3N7O |
| Molecular Weight | 557.58 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | (2S)-2-(2,4-difluorophenyl)-1-[[2-(4-fluorophenyl)-3-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]pyrazolo[1,5-a]pyridin-7-yl]amino]-3-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | C=N/C=C\C(=C/C)c1c(-c2ccc(F)cc2)nn2c(NC[C@](O)(Cn3cncn3)c3ccc(F)cc3F)cccc12 |
| InChI | InChI=1S/C30H26F3N7O/c1-3-20(13-14-34-2)28-26-5-4-6-27(40(26)38-29(28)21-7-9-22(31)10-8-21)36-16-30(41,17-39-19-35-18-37-39)24-12-11-23(32)15-25(24)33/h3-15,18-19,36,41H,2,16-17H2,1H3/b14-13-,20-3+/t30-/m0/s1 |
| InChIKey | WXXIRIHHEIXRQI-YTPZUBATSA-N |
| XLogP | 5.63 |
| TPSA | 92.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.58 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|