C5H5F6N — CID 174357880
1,1,2-trifluoro-N-methyl-N-(trifluoromethyl)prop-2-en-1-amine (PubChem CID 174357880) has the molecular formula C5H5F6N and a molecular weight of 193.09 g/mol. Its IUPAC name is 1,1,2-trifluoro-N-methyl-N-(trifluoromethyl)prop-2-en-1-amine.
| Compound Name | 1,1,2-trifluoro-N-methyl-N-(trifluoromethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 174357880 |
| Molecular Formula | C5H5F6N |
| Molecular Weight | 193.09 g/mol |
| Exact Mass | 193.03 |
| IUPAC Name | 1,1,2-trifluoro-N-methyl-N-(trifluoromethyl)prop-2-en-1-amine |
| SMILES | C=C(F)C(F)(F)N(C)C(F)(F)F |
| InChI | InChI=1S/C5H5F6N/c1-3(6)4(7,8)12(2)5(9,10)11/h1H2,2H3 |
| InChIKey | DLMPFXPEQICGNA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.09 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|