C28H28N2O3 — CID 174358857
5-[[2-butyl-4-[hydroxy(phenyl)methyl]imidazol-1-yl]methyl]-2-phenylbenzoic acid (PubChem CID 174358857) has the molecular formula C28H28N2O3 and a molecular weight of 440.54 g/mol. Its IUPAC name is 5-[[2-butyl-4-[hydroxy(phenyl)methyl]imidazol-1-yl]methyl]-2-phenylbenzoic acid.
| Compound Name | 5-[[2-butyl-4-[hydroxy(phenyl)methyl]imidazol-1-yl]methyl]-2-phenylbenzoic acid |
|---|---|
| PubChem CID | 174358857 |
| Molecular Formula | C28H28N2O3 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 5-[[2-butyl-4-[hydroxy(phenyl)methyl]imidazol-1-yl]methyl]-2-phenylbenzoic acid |
| SMILES | CCCCc1nc(C(O)c2ccccc2)cn1Cc1ccc(-c2ccccc2)c(C(=O)O)c1 |
| InChI | InChI=1S/C28H28N2O3/c1-2-3-14-26-29-25(27(31)22-12-8-5-9-13-22)19-30(26)18-20-15-16-23(24(17-20)28(32)33)21-10-6-4-7-11-21/h4-13,15-17,19,27,31H,2-3,14,18H2,1H3,(H,32,33) |
| InChIKey | LFCVNLZMKWMOAP-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |