C25H28FN3O6S — CID 174359150
1-cyclopropyl-6-fluoro-8-methoxy-7-[5-methyl-6-(pentylsulfamoyl)-3-pyridinyl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 174359150) has the molecular formula C25H28FN3O6S and a molecular weight of 517.58 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-8-methoxy-7-[5-methyl-6-(pentylsulfamoyl)-3-pyridinyl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-6-fluoro-8-methoxy-7-[5-methyl-6-(pentylsulfamoyl)-3-pyridinyl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 174359150 |
| Molecular Formula | C25H28FN3O6S |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-8-methoxy-7-[5-methyl-6-(pentylsulfamoyl)-3-pyridinyl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCCCCNS(=O)(=O)c1ncc(-c2c(F)cc3c(=O)c(C(=O)O)cn(C4CC4)c3c2OC)cc1C |
| InChI | InChI=1S/C25H28FN3O6S/c1-4-5-6-9-28-36(33,34)24-14(2)10-15(12-27-24)20-19(26)11-17-21(23(20)35-3)29(16-7-8-16)13-18(22(17)30)25(31)32/h10-13,16,28H,4-9H2,1-3H3,(H,31,32) |
| InChIKey | ISBWFOVBAQGCKV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|