C19H16FN3O5 — CID 174358631
1-cyclopropyl-6-fluoro-7-[5-(hydroxyamino)-2-pyridinyl]-8-methoxy-4-oxoquinoline-3-carboxylic acid (PubChem CID 174358631) has the molecular formula C19H16FN3O5 and a molecular weight of 385.35 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-7-[5-(hydroxyamino)-2-pyridinyl]-8-methoxy-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-6-fluoro-7-[5-(hydroxyamino)-2-pyridinyl]-8-methoxy-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 174358631 |
| Molecular Formula | C19H16FN3O5 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-7-[5-(hydroxyamino)-2-pyridinyl]-8-methoxy-4-oxoquinoline-3-carboxylic acid |
| SMILES | COc1c(-c2ccc(NO)cn2)c(F)cc2c(=O)c(C(=O)O)cn(C3CC3)c12 |
| InChI | InChI=1S/C19H16FN3O5/c1-28-18-15(14-5-2-9(22-27)7-21-14)13(20)6-11-16(18)23(10-3-4-10)8-12(17(11)24)19(25)26/h2,5-8,10,22,27H,3-4H2,1H3,(H,25,26) |
| InChIKey | JEOIRZIUWQZBPJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|