About sodium;3,3-dimethylpyrrole;hydride
sodium;3,3-dimethylpyrrole;hydride (PubChem CID 174360500) has the molecular formula C6H10NNa
and a molecular weight of 119.14 g/mol. Its IUPAC name is sodium;3,3-dimethylpyrrole;hydride.
Molecular Properties
| Compound Name | sodium;3,3-dimethylpyrrole;hydride |
| PubChem CID | 174360500 |
| Molecular Formula | C6H10NNa |
| Molecular Weight | 119.14 g/mol |
| Exact Mass | 119.07 |
| IUPAC Name | sodium;3,3-dimethylpyrrole;hydride |
| SMILES | CC1(C)C=CN=C1.[H-].[Na+] |
| InChI | InChI=1S/C6H9N.Na.H/c1-6(2)3-4-7-5-6;;/h3-5H,1-2H3;;/q;+1;-1 |
| InChIKey | RHEIHZOHNUPQSO-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.14 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze sodium;3,3-dimethylpyrrole;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;3,3-dimethylpyrrole;hydride?
The IUPAC name of sodium;3,3-dimethylpyrrole;hydride (CID 174360500) is sodium;3,3-dimethylpyrrole;hydride.
What is the SMILES notation for sodium;3,3-dimethylpyrrole;hydride?
The canonical SMILES for sodium;3,3-dimethylpyrrole;hydride is CC1(C)C=CN=C1.[H-].[Na+].
What is the InChIKey of sodium;3,3-dimethylpyrrole;hydride?
The InChIKey is RHEIHZOHNUPQSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N.Na.H/c1-6(2)3-4-7-5-6;;/h3-5H,1-2H3;;/q;+1;-1.
What are the key properties of sodium;3,3-dimethylpyrrole;hydride?
sodium;3,3-dimethylpyrrole;hydride has a molecular weight of 119.14 g/mol, XLogP of -1.27, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;3,3-dimethylpyrrole;hydride is sourced from PubChem (CID 174360500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).