About 4-(3,4-dihydropyrazol-2-yl)-2H-triazole
4-(3,4-dihydropyrazol-2-yl)-2H-triazole (PubChem CID 174361598) has the molecular formula C5H7N5
and a molecular weight of 137.15 g/mol. Its IUPAC name is 4-(3,4-dihydropyrazol-2-yl)-2H-triazole.
Molecular Properties
| Compound Name | 4-(3,4-dihydropyrazol-2-yl)-2H-triazole |
| PubChem CID | 174361598 |
| Molecular Formula | C5H7N5 |
| Molecular Weight | 137.15 g/mol |
| Exact Mass | 137.07 |
| IUPAC Name | 4-(3,4-dihydropyrazol-2-yl)-2H-triazole |
| SMILES | C1=NN(c2cn[nH]n2)CC1 |
| InChI | InChI=1S/C5H7N5/c1-2-7-10(3-1)5-4-6-9-8-5/h2,4H,1,3H2,(H,6,8,9) |
| InChIKey | UMRPCPIGUSRYMS-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.15 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3,4-dihydropyrazol-2-yl)-2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dihydropyrazol-2-yl)-2H-triazole?
The IUPAC name of 4-(3,4-dihydropyrazol-2-yl)-2H-triazole (CID 174361598) is 4-(3,4-dihydropyrazol-2-yl)-2H-triazole.
What is the SMILES notation for 4-(3,4-dihydropyrazol-2-yl)-2H-triazole?
The canonical SMILES for 4-(3,4-dihydropyrazol-2-yl)-2H-triazole is C1=NN(c2cn[nH]n2)CC1.
What is the InChIKey of 4-(3,4-dihydropyrazol-2-yl)-2H-triazole?
The InChIKey is UMRPCPIGUSRYMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N5/c1-2-7-10(3-1)5-4-6-9-8-5/h2,4H,1,3H2,(H,6,8,9).
What are the key properties of 4-(3,4-dihydropyrazol-2-yl)-2H-triazole?
4-(3,4-dihydropyrazol-2-yl)-2H-triazole has a molecular weight of 137.15 g/mol, XLogP of 0.00, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dihydropyrazol-2-yl)-2H-triazole is sourced from PubChem (CID 174361598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).