C6H6N4O2 — CID 70083719
1-(2H-triazol-4-yl)pyrrolidine-2,5-dione (PubChem CID 70083719) has the molecular formula C6H6N4O2 and a molecular weight of 166.14 g/mol. Its IUPAC name is 1-(2H-triazol-4-yl)pyrrolidine-2,5-dione.
| Compound Name | 1-(2H-triazol-4-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 70083719 |
| Molecular Formula | C6H6N4O2 |
| Molecular Weight | 166.14 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 1-(2H-triazol-4-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1c1cn[nH]n1 |
| InChI | InChI=1S/C6H6N4O2/c11-5-1-2-6(12)10(5)4-3-7-9-8-4/h3H,1-2H2,(H,7,8,9) |
| InChIKey | FOTSHCUGMOOYOT-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.14 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|