C9H11N3O2 — CID 43547645
1-(3,5-dimethyl-1H-pyrazol-4-yl)pyrrolidine-2,5-dione (PubChem CID 43547645) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1H-pyrazol-4-yl)pyrrolidine-2,5-dione.
| Compound Name | 1-(3,5-dimethyl-1H-pyrazol-4-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 43547645 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 1-(3,5-dimethyl-1H-pyrazol-4-yl)pyrrolidine-2,5-dione |
| SMILES | Cc1n[nH]c(C)c1N1C(=O)CCC1=O |
| InChI | InChI=1S/C9H11N3O2/c1-5-9(6(2)11-10-5)12-7(13)3-4-8(12)14/h3-4H2,1-2H3,(H,10,11) |
| InChIKey | YSPXYBZUHMHFCS-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|