C13H19N3O2 — CID 43547642
1-(3,5-dimethyl-1H-pyrazol-4-yl)-3-methyl-3-propan-2-ylpyrrolidine-2,5-dione (PubChem CID 43547642) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1H-pyrazol-4-yl)-3-methyl-3-propan-2-ylpyrrolidine-2,5-dione.
| Compound Name | 1-(3,5-dimethyl-1H-pyrazol-4-yl)-3-methyl-3-propan-2-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 43547642 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 1-(3,5-dimethyl-1H-pyrazol-4-yl)-3-methyl-3-propan-2-ylpyrrolidine-2,5-dione |
| SMILES | Cc1n[nH]c(C)c1N1C(=O)CC(C)(C(C)C)C1=O |
| InChI | InChI=1S/C13H19N3O2/c1-7(2)13(5)6-10(17)16(12(13)18)11-8(3)14-15-9(11)4/h7H,6H2,1-5H3,(H,14,15) |
| InChIKey | HOCUMVZTUVZEOJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|