C14H18N4O3 — CID 115946879
4-(3,5-dimethyl-1H-pyrazol-4-yl)-2,4-diazaspiro[5.5]undecane-1,3,5-trione (PubChem CID 115946879) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 4-(3,5-dimethyl-1H-pyrazol-4-yl)-2,4-diazaspiro[5.5]undecane-1,3,5-trione.
| Compound Name | 4-(3,5-dimethyl-1H-pyrazol-4-yl)-2,4-diazaspiro[5.5]undecane-1,3,5-trione |
|---|---|
| PubChem CID | 115946879 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 4-(3,5-dimethyl-1H-pyrazol-4-yl)-2,4-diazaspiro[5.5]undecane-1,3,5-trione |
| SMILES | Cc1n[nH]c(C)c1N1C(=O)NC(=O)C2(CCCCC2)C1=O |
| InChI | InChI=1S/C14H18N4O3/c1-8-10(9(2)17-16-8)18-12(20)14(6-4-3-5-7-14)11(19)15-13(18)21/h3-7H2,1-2H3,(H,16,17)(H,15,19,21) |
| InChIKey | AXFQKHZQJPGSHE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|