About N-(diaminomethylidene)formamide;5-fluoro-1-methylindole;hydrochloride
N-(diaminomethylidene)formamide;5-fluoro-1-methylindole;hydrochloride (PubChem CID 174361638) has the molecular formula C11H14ClFN4O
and a molecular weight of 272.71 g/mol. Its IUPAC name is N-(diaminomethylidene)formamide;5-fluoro-1-methylindole;hydrochloride.
Molecular Properties
| Compound Name | N-(diaminomethylidene)formamide;5-fluoro-1-methylindole;hydrochloride |
| PubChem CID | 174361638 |
| Molecular Formula | C11H14ClFN4O |
| Molecular Weight | 272.71 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | N-(diaminomethylidene)formamide;5-fluoro-1-methylindole;hydrochloride |
| SMILES | Cl.Cn1ccc2cc(F)ccc21.NC(N)=NC=O |
| InChI | InChI=1S/C9H8FN.C2H5N3O.ClH/c1-11-5-4-7-6-8(10)2-3-9(7)11;3-2(4)5-1-6;/h2-6H,1H3;1H,(H4,3,4,5,6);1H |
| InChIKey | ZMDSRLKMUKVKSH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 86.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.71 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(diaminomethylidene)formamide;5-fluoro-1-methylindole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(diaminomethylidene)formamide;5-fluoro-1-methylindole;hydrochloride?
The IUPAC name of N-(diaminomethylidene)formamide;5-fluoro-1-methylindole;hydrochloride (CID 174361638) is N-(diaminomethylidene)formamide;5-fluoro-1-methylindole;hydrochloride.
What is the SMILES notation for N-(diaminomethylidene)formamide;5-fluoro-1-methylindole;hydrochloride?
The canonical SMILES for N-(diaminomethylidene)formamide;5-fluoro-1-methylindole;hydrochloride is Cl.Cn1ccc2cc(F)ccc21.NC(N)=NC=O.
What is the InChIKey of N-(diaminomethylidene)formamide;5-fluoro-1-methylindole;hydrochloride?
The InChIKey is ZMDSRLKMUKVKSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FN.C2H5N3O.ClH/c1-11-5-4-7-6-8(10)2-3-9(7)11;3-2(4)5-1-6;/h2-6H,1H3;1H,(H4,3,4,5,6);1H.
What are the key properties of N-(diaminomethylidene)formamide;5-fluoro-1-methylindole;hydrochloride?
N-(diaminomethylidene)formamide;5-fluoro-1-methylindole;hydrochloride has a molecular weight of 272.71 g/mol, XLogP of 1.16, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(diaminomethylidene)formamide;5-fluoro-1-methylindole;hydrochloride is sourced from PubChem (CID 174361638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).