C20H16Cl2F2N2O3 — CID 174363439
3-(4,6-dichloro-1H-indol-3-yl)-N-(2,4-difluorophenyl)prop-2-enamide;ethyl formate (PubChem CID 174363439) has the molecular formula C20H16Cl2F2N2O3 and a molecular weight of 441.26 g/mol. Its IUPAC name is 3-(4,6-dichloro-1H-indol-3-yl)-N-(2,4-difluorophenyl)prop-2-enamide;ethyl formate.
| Compound Name | 3-(4,6-dichloro-1H-indol-3-yl)-N-(2,4-difluorophenyl)prop-2-enamide;ethyl formate |
|---|---|
| PubChem CID | 174363439 |
| Molecular Formula | C20H16Cl2F2N2O3 |
| Molecular Weight | 441.26 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | 3-(4,6-dichloro-1H-indol-3-yl)-N-(2,4-difluorophenyl)prop-2-enamide;ethyl formate |
| SMILES | CCOC=O.O=C(C=Cc1c[nH]c2cc(Cl)cc(Cl)c12)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C17H10Cl2F2N2O.C3H6O2/c18-10-5-12(19)17-9(8-22-15(17)6-10)1-4-16(24)23-14-3-2-11(20)7-13(14)21;1-2-5-3-4/h1-8,22H,(H,23,24);3H,2H2,1H3 |
| InChIKey | YMPINKSKVJACRO-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.26 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|