C13H19N3S — CID 174365009
(5S)-3-methyl-1'-sulfanylspiro[5,7-dihydrocyclopenta[b]pyridine-6,4'-piperidine]-5-amine (PubChem CID 174365009) has the molecular formula C13H19N3S and a molecular weight of 249.38 g/mol. Its IUPAC name is (5S)-3-methyl-1'-sulfanylspiro[5,7-dihydrocyclopenta[b]pyridine-6,4'-piperidine]-5-amine.
| Compound Name | (5S)-3-methyl-1'-sulfanylspiro[5,7-dihydrocyclopenta[b]pyridine-6,4'-piperidine]-5-amine |
|---|---|
| PubChem CID | 174365009 |
| Molecular Formula | C13H19N3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | (5S)-3-methyl-1'-sulfanylspiro[5,7-dihydrocyclopenta[b]pyridine-6,4'-piperidine]-5-amine |
| SMILES | Cc1cnc2c(c1)[C@@H](N)C1(CCN(S)CC1)C2 |
| InChI | InChI=1S/C13H19N3S/c1-9-6-10-11(15-8-9)7-13(12(10)14)2-4-16(17)5-3-13/h6,8,12,17H,2-5,7,14H2,1H3/t12-/m1/s1 |
| InChIKey | WCKSLQBUNNSVFB-GFCCVEGCSA-N |
| XLogP | 1.87 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|