ethyl(dimethyl)stannane;2-methylprop-2-enoic acid

C8H18O2Sn — CID 174366795

IUPACethyl(dimethyl)stannane;2-methylprop-2-enoic acid
SMILESC=C(C)C(=O)O.CC[SnH](C)C
InChIInChI=1S/C4H6O2.C2H5.2CH3.Sn.H/c1-3(2)4(5)6;1-2;;;;/h1H2,2H3,(H,5,6);1H2,2H3;2*1H3;;
InChIKeyQVMIQVWAUWXAJO-UHFFFAOYSA-N
MW264.94 g/mol
LogP2.14
Rot. Bonds2

About ethyl(dimethyl)stannane;2-methylprop-2-enoic acid

ethyl(dimethyl)stannane;2-methylprop-2-enoic acid (PubChem CID 174366795) has the molecular formula C8H18O2Sn and a molecular weight of 264.94 g/mol. Its IUPAC name is ethyl(dimethyl)stannane;2-methylprop-2-enoic acid.

Molecular Properties

Compound Nameethyl(dimethyl)stannane;2-methylprop-2-enoic acid
PubChem CID174366795
Molecular FormulaC8H18O2Sn
Molecular Weight264.94 g/mol
Exact Mass266.03
IUPAC Nameethyl(dimethyl)stannane;2-methylprop-2-enoic acid
SMILESC=C(C)C(=O)O.CC[SnH](C)C
InChIInChI=1S/C4H6O2.C2H5.2CH3.Sn.H/c1-3(2)4(5)6;1-2;;;;/h1H2,2H3,(H,5,6);1H2,2H3;2*1H3;;
InChIKeyQVMIQVWAUWXAJO-UHFFFAOYSA-N
XLogP2.14
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.94
LogP ≤ 52.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze ethyl(dimethyl)stannane;2-methylprop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl(dimethyl)stannane;2-methylprop-2-enoic acid?
The IUPAC name of ethyl(dimethyl)stannane;2-methylprop-2-enoic acid (CID 174366795) is ethyl(dimethyl)stannane;2-methylprop-2-enoic acid.
What is the SMILES notation for ethyl(dimethyl)stannane;2-methylprop-2-enoic acid?
The canonical SMILES for ethyl(dimethyl)stannane;2-methylprop-2-enoic acid is C=C(C)C(=O)O.CC[SnH](C)C.
What is the InChIKey of ethyl(dimethyl)stannane;2-methylprop-2-enoic acid?
The InChIKey is QVMIQVWAUWXAJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.C2H5.2CH3.Sn.H/c1-3(2)4(5)6;1-2;;;;/h1H2,2H3,(H,5,6);1H2,2H3;2*1H3;;.
What are the key properties of ethyl(dimethyl)stannane;2-methylprop-2-enoic acid?
ethyl(dimethyl)stannane;2-methylprop-2-enoic acid has a molecular weight of 264.94 g/mol, XLogP of 2.14, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl(dimethyl)stannane;2-methylprop-2-enoic acid is sourced from PubChem (CID 174366795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).