C24H25Cl2N2O3S2- — CID 174367590
[4-[cyclopropyl-[[4-(2,4-dichlorophenyl)-5-methyl-1,3-thiazol-2-yl]-propylamino]methyl]phenyl]methyl sulfite (PubChem CID 174367590) has the molecular formula C24H25Cl2N2O3S2- and a molecular weight of 524.52 g/mol. Its IUPAC name is [4-[cyclopropyl-[[4-(2,4-dichlorophenyl)-5-methyl-1,3-thiazol-2-yl]-propylamino]methyl]phenyl]methyl sulfite.
| Compound Name | [4-[cyclopropyl-[[4-(2,4-dichlorophenyl)-5-methyl-1,3-thiazol-2-yl]-propylamino]methyl]phenyl]methyl sulfite |
|---|---|
| PubChem CID | 174367590 |
| Molecular Formula | C24H25Cl2N2O3S2- |
| Molecular Weight | 524.52 g/mol |
| Exact Mass | 523.07 |
| IUPAC Name | [4-[cyclopropyl-[[4-(2,4-dichlorophenyl)-5-methyl-1,3-thiazol-2-yl]-propylamino]methyl]phenyl]methyl sulfite |
| SMILES | CCCN(c1nc(-c2ccc(Cl)cc2Cl)c(C)s1)C(c1ccc(COS(=O)[O-])cc1)C1CC1 |
| InChI | InChI=1S/C24H26Cl2N2O3S2/c1-3-12-28(24-27-22(15(2)32-24)20-11-10-19(25)13-21(20)26)23(18-8-9-18)17-6-4-16(5-7-17)14-31-33(29)30/h4-7,10-11,13,18,23H,3,8-9,12,14H2,1-2H3,(H,29,30)/p-1 |
| InChIKey | ICTDJRXZEYEXIG-UHFFFAOYSA-M |
| XLogP | 7.10 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.52 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|