C28H34Cl2N2O3S — CID 57149312
4-(2,4-dichlorophenyl)-5-methyl-N-[2-[2-(oxan-2-yloxy)ethoxy]-1-phenylethyl]-N-propyl-1,3-thiazol-2-amine (PubChem CID 57149312) has the molecular formula C28H34Cl2N2O3S and a molecular weight of 549.56 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-5-methyl-N-[2-[2-(oxan-2-yloxy)ethoxy]-1-phenylethyl]-N-propyl-1,3-thiazol-2-amine.
| Compound Name | 4-(2,4-dichlorophenyl)-5-methyl-N-[2-[2-(oxan-2-yloxy)ethoxy]-1-phenylethyl]-N-propyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 57149312 |
| Molecular Formula | C28H34Cl2N2O3S |
| Molecular Weight | 549.56 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-5-methyl-N-[2-[2-(oxan-2-yloxy)ethoxy]-1-phenylethyl]-N-propyl-1,3-thiazol-2-amine |
| SMILES | CCCN(c1nc(-c2ccc(Cl)cc2Cl)c(C)s1)C(COCCOC1CCCCO1)c1ccccc1 |
| InChI | InChI=1S/C28H34Cl2N2O3S/c1-3-14-32(28-31-27(20(2)36-28)23-13-12-22(29)18-24(23)30)25(21-9-5-4-6-10-21)19-33-16-17-35-26-11-7-8-15-34-26/h4-6,9-10,12-13,18,25-26H,3,7-8,11,14-17,19H2,1-2H3 |
| InChIKey | GPEZHKRGRNQTBF-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.56 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|