C12H20NZr- — CID 174367992
2,5-ditert-butyl-1,3-dihydropyrrol-3-ide;zirconium (PubChem CID 174367992) has the molecular formula C12H20NZr- and a molecular weight of 269.52 g/mol. Its IUPAC name is 2,5-ditert-butyl-1,3-dihydropyrrol-3-ide;zirconium.
| Compound Name | 2,5-ditert-butyl-1,3-dihydropyrrol-3-ide;zirconium |
|---|---|
| PubChem CID | 174367992 |
| Molecular Formula | C12H20NZr- |
| Molecular Weight | 269.52 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 2,5-ditert-butyl-1,3-dihydropyrrol-3-ide;zirconium |
| SMILES | CC(C)(C)c1[c-]cc(C(C)(C)C)[nH]1.[Zr] |
| InChI | InChI=1S/C12H20N.Zr/c1-11(2,3)9-7-8-10(13-9)12(4,5)6;/h7,13H,1-6H3;/q-1; |
| InChIKey | CVGTWLPRMJXQGQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|