C18H19BrN4O4 — CID 174370186
6-bromo-8-(3,4-dihydro-2H-quinolin-1-ylmethyl)-5-nitro-1,2,3,4-tetrahydroquinoxaline-2,3-diol (PubChem CID 174370186) has the molecular formula C18H19BrN4O4 and a molecular weight of 435.28 g/mol. Its IUPAC name is 6-bromo-8-(3,4-dihydro-2H-quinolin-1-ylmethyl)-5-nitro-1,2,3,4-tetrahydroquinoxaline-2,3-diol.
| Compound Name | 6-bromo-8-(3,4-dihydro-2H-quinolin-1-ylmethyl)-5-nitro-1,2,3,4-tetrahydroquinoxaline-2,3-diol |
|---|---|
| PubChem CID | 174370186 |
| Molecular Formula | C18H19BrN4O4 |
| Molecular Weight | 435.28 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | 6-bromo-8-(3,4-dihydro-2H-quinolin-1-ylmethyl)-5-nitro-1,2,3,4-tetrahydroquinoxaline-2,3-diol |
| SMILES | O=[N+]([O-])c1c(Br)cc(CN2CCCc3ccccc32)c2c1NC(O)C(O)N2 |
| InChI | InChI=1S/C18H19BrN4O4/c19-12-8-11(9-22-7-3-5-10-4-1-2-6-13(10)22)14-15(16(12)23(26)27)21-18(25)17(24)20-14/h1-2,4,6,8,17-18,20-21,24-25H,3,5,7,9H2 |
| InChIKey | SABRVHNGDCTPNL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|