About bis(2-cyanoethoxyphosphonamidous acid);sulfane
bis(2-cyanoethoxyphosphonamidous acid);sulfane (PubChem CID 174370903) has the molecular formula C6H16N4O4P2S
and a molecular weight of 302.23 g/mol. Its IUPAC name is bis(2-cyanoethoxyphosphonamidous acid);sulfane.
Molecular Properties
| Compound Name | bis(2-cyanoethoxyphosphonamidous acid);sulfane |
| PubChem CID | 174370903 |
| Molecular Formula | C6H16N4O4P2S |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | bis(2-cyanoethoxyphosphonamidous acid);sulfane |
| SMILES | N#CCCOP(N)O.N#CCCOP(N)O.S |
| InChI | InChI=1S/2C3H7N2O2P.H2S/c2*4-2-1-3-7-8(5)6;/h2*6H,1,3,5H2;1H2 |
| InChIKey | REFSCEXUZHXWQX-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 158.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(2-cyanoethoxyphosphonamidous acid);sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-cyanoethoxyphosphonamidous acid);sulfane?
The IUPAC name of bis(2-cyanoethoxyphosphonamidous acid);sulfane (CID 174370903) is bis(2-cyanoethoxyphosphonamidous acid);sulfane.
What is the SMILES notation for bis(2-cyanoethoxyphosphonamidous acid);sulfane?
The canonical SMILES for bis(2-cyanoethoxyphosphonamidous acid);sulfane is N#CCCOP(N)O.N#CCCOP(N)O.S.
What is the InChIKey of bis(2-cyanoethoxyphosphonamidous acid);sulfane?
The InChIKey is REFSCEXUZHXWQX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H7N2O2P.H2S/c2*4-2-1-3-7-8(5)6;/h2*6H,1,3,5H2;1H2.
What are the key properties of bis(2-cyanoethoxyphosphonamidous acid);sulfane?
bis(2-cyanoethoxyphosphonamidous acid);sulfane has a molecular weight of 302.23 g/mol, XLogP of 0.30, 6 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-cyanoethoxyphosphonamidous acid);sulfane is sourced from PubChem (CID 174370903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).