C52H50F2N2O4 — CID 174371552
bis(4-(4-fluorophenyl)-1-[1-(4-phenylphenyl)ethyl]-3,6-dihydro-2H-pyridine);oxalic acid (PubChem CID 174371552) has the molecular formula C52H50F2N2O4 and a molecular weight of 804.98 g/mol. Its IUPAC name is bis(4-(4-fluorophenyl)-1-[1-(4-phenylphenyl)ethyl]-3,6-dihydro-2H-pyridine);oxalic acid.
| Compound Name | bis(4-(4-fluorophenyl)-1-[1-(4-phenylphenyl)ethyl]-3,6-dihydro-2H-pyridine);oxalic acid |
|---|---|
| PubChem CID | 174371552 |
| Molecular Formula | C52H50F2N2O4 |
| Molecular Weight | 804.98 g/mol |
| Exact Mass | 804.37 |
| IUPAC Name | bis(4-(4-fluorophenyl)-1-[1-(4-phenylphenyl)ethyl]-3,6-dihydro-2H-pyridine);oxalic acid |
| SMILES | CC(c1ccc(-c2ccccc2)cc1)N1CC=C(c2ccc(F)cc2)CC1.CC(c1ccc(-c2ccccc2)cc1)N1CC=C(c2ccc(F)cc2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/2C25H24FN.C2H2O4/c2*1-19(20-7-9-22(10-8-20)21-5-3-2-4-6-21)27-17-15-24(16-18-27)23-11-13-25(26)14-12-23;3-1(4)2(5)6/h2*2-15,19H,16-18H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | JLGKLHUXVHZDKU-UHFFFAOYSA-N |
| XLogP | 11.84 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.98 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|