About 1-[(1R)-1-(3-nitrophenyl)ethyl]-4-phenyl-3,6-dihydro-2H-pyridine
1-[(1R)-1-(3-nitrophenyl)ethyl]-4-phenyl-3,6-dihydro-2H-pyridine (PubChem CID 8754233) has the molecular formula C19H20N2O2
and a molecular weight of 308.38 g/mol. Its IUPAC name is 1-[(1R)-1-(3-nitrophenyl)ethyl]-4-phenyl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 1-[(1R)-1-(3-nitrophenyl)ethyl]-4-phenyl-3,6-dihydro-2H-pyridine |
| PubChem CID | 8754233 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 1-[(1R)-1-(3-nitrophenyl)ethyl]-4-phenyl-3,6-dihydro-2H-pyridine |
| SMILES | C[C@H](c1cccc([N+](=O)[O-])c1)N1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H20N2O2/c1-15(18-8-5-9-19(14-18)21(22)23)20-12-10-17(11-13-20)16-6-3-2-4-7-16/h2-10,14-15H,11-13H2,1H3/t15-/m1/s1 |
| InChIKey | KKRDTKQQLLKTQS-OAHLLOKOSA-N |
| XLogP | 4.45 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1R)-1-(3-nitrophenyl)ethyl]-4-phenyl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R)-1-(3-nitrophenyl)ethyl]-4-phenyl-3,6-dihydro-2H-pyridine?
The IUPAC name of 1-[(1R)-1-(3-nitrophenyl)ethyl]-4-phenyl-3,6-dihydro-2H-pyridine (CID 8754233) is 1-[(1R)-1-(3-nitrophenyl)ethyl]-4-phenyl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 1-[(1R)-1-(3-nitrophenyl)ethyl]-4-phenyl-3,6-dihydro-2H-pyridine?
The canonical SMILES for 1-[(1R)-1-(3-nitrophenyl)ethyl]-4-phenyl-3,6-dihydro-2H-pyridine is C[C@H](c1cccc([N+](=O)[O-])c1)N1CC=C(c2ccccc2)CC1.
What is the InChIKey of 1-[(1R)-1-(3-nitrophenyl)ethyl]-4-phenyl-3,6-dihydro-2H-pyridine?
The InChIKey is KKRDTKQQLLKTQS-OAHLLOKOSA-N. The full InChI is InChI=1S/C19H20N2O2/c1-15(18-8-5-9-19(14-18)21(22)23)20-12-10-17(11-13-20)16-6-3-2-4-7-16/h2-10,14-15H,11-13H2,1H3/t15-/m1/s1.
What are the key properties of 1-[(1R)-1-(3-nitrophenyl)ethyl]-4-phenyl-3,6-dihydro-2H-pyridine?
1-[(1R)-1-(3-nitrophenyl)ethyl]-4-phenyl-3,6-dihydro-2H-pyridine has a molecular weight of 308.38 g/mol, XLogP of 4.45, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R)-1-(3-nitrophenyl)ethyl]-4-phenyl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 8754233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).