C13H12BrO3S+ — CID 174372307
[4-(3-bromo-5,5-dimethyl-4-oxofuran-2-yl)phenyl]methyl-oxosulfanium (PubChem CID 174372307) has the molecular formula C13H12BrO3S+ and a molecular weight of 328.21 g/mol. Its IUPAC name is [4-(3-bromo-5,5-dimethyl-4-oxofuran-2-yl)phenyl]methyl-oxosulfanium.
| Compound Name | [4-(3-bromo-5,5-dimethyl-4-oxofuran-2-yl)phenyl]methyl-oxosulfanium |
|---|---|
| PubChem CID | 174372307 |
| Molecular Formula | C13H12BrO3S+ |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | [4-(3-bromo-5,5-dimethyl-4-oxofuran-2-yl)phenyl]methyl-oxosulfanium |
| SMILES | CC1(C)OC(c2ccc(C[S+]=O)cc2)=C(Br)C1=O |
| InChI | InChI=1S/C13H12BrO3S/c1-13(2)12(15)10(14)11(17-13)9-5-3-8(4-6-9)7-18-16/h3-6H,7H2,1-2H3/q+1 |
| InChIKey | HAHWSPQKTSIZNS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|