C11H19NO — CID 174376632
5-(dimethylamino)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde (PubChem CID 174376632) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 5-(dimethylamino)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde.
| Compound Name | 5-(dimethylamino)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 174376632 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 5-(dimethylamino)-4,4-dimethylcyclohex-2-ene-1-carbaldehyde |
| SMILES | CN(C)C1CC(C=O)C=CC1(C)C |
| InChI | InChI=1S/C11H19NO/c1-11(2)6-5-9(8-13)7-10(11)12(3)4/h5-6,8-10H,7H2,1-4H3 |
| InChIKey | MDWBWUHLOFBWEU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|