C20H26N2O6S — CID 174376880
[2-(aminomethyl)-4-[(3,5-dimethoxyphenyl)methylsulfamoyl]phenyl] butanoate (PubChem CID 174376880) has the molecular formula C20H26N2O6S and a molecular weight of 422.50 g/mol. Its IUPAC name is [2-(aminomethyl)-4-[(3,5-dimethoxyphenyl)methylsulfamoyl]phenyl] butanoate.
| Compound Name | [2-(aminomethyl)-4-[(3,5-dimethoxyphenyl)methylsulfamoyl]phenyl] butanoate |
|---|---|
| PubChem CID | 174376880 |
| Molecular Formula | C20H26N2O6S |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | [2-(aminomethyl)-4-[(3,5-dimethoxyphenyl)methylsulfamoyl]phenyl] butanoate |
| SMILES | CCCC(=O)Oc1ccc(S(=O)(=O)NCc2cc(OC)cc(OC)c2)cc1CN |
| InChI | InChI=1S/C20H26N2O6S/c1-4-5-20(23)28-19-7-6-18(10-15(19)12-21)29(24,25)22-13-14-8-16(26-2)11-17(9-14)27-3/h6-11,22H,4-5,12-13,21H2,1-3H3 |
| InChIKey | DDXKEZQWRZEYEX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|