About propoxycarbonyl but-2-eneperoxoate
propoxycarbonyl but-2-eneperoxoate (PubChem CID 174379479) has the molecular formula C8H12O5
and a molecular weight of 188.18 g/mol. Its IUPAC name is propoxycarbonyl but-2-eneperoxoate.
Molecular Properties
| Compound Name | propoxycarbonyl but-2-eneperoxoate |
| PubChem CID | 174379479 |
| Molecular Formula | C8H12O5 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | propoxycarbonyl but-2-eneperoxoate |
| SMILES | CC=CC(=O)OOC(=O)OCCC |
| InChI | InChI=1S/C8H12O5/c1-3-5-7(9)12-13-8(10)11-6-4-2/h3,5H,4,6H2,1-2H3 |
| InChIKey | DQHNWCGWVHNKNR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze propoxycarbonyl but-2-eneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propoxycarbonyl but-2-eneperoxoate?
The IUPAC name of propoxycarbonyl but-2-eneperoxoate (CID 174379479) is propoxycarbonyl but-2-eneperoxoate.
What is the SMILES notation for propoxycarbonyl but-2-eneperoxoate?
The canonical SMILES for propoxycarbonyl but-2-eneperoxoate is CC=CC(=O)OOC(=O)OCCC.
What is the InChIKey of propoxycarbonyl but-2-eneperoxoate?
The InChIKey is DQHNWCGWVHNKNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O5/c1-3-5-7(9)12-13-8(10)11-6-4-2/h3,5H,4,6H2,1-2H3.
What are the key properties of propoxycarbonyl but-2-eneperoxoate?
propoxycarbonyl but-2-eneperoxoate has a molecular weight of 188.18 g/mol, XLogP of 1.58, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propoxycarbonyl but-2-eneperoxoate is sourced from PubChem (CID 174379479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).