C24H29N3O3 — CID 174379763
2-[(4-aminophenyl)methyl]-6-(3-cyclopentyloxy-4-methoxyphenyl)-4,5-dihydro-3H-pyridazine-3-carbaldehyde (PubChem CID 174379763) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is 2-[(4-aminophenyl)methyl]-6-(3-cyclopentyloxy-4-methoxyphenyl)-4,5-dihydro-3H-pyridazine-3-carbaldehyde.
| Compound Name | 2-[(4-aminophenyl)methyl]-6-(3-cyclopentyloxy-4-methoxyphenyl)-4,5-dihydro-3H-pyridazine-3-carbaldehyde |
|---|---|
| PubChem CID | 174379763 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 2-[(4-aminophenyl)methyl]-6-(3-cyclopentyloxy-4-methoxyphenyl)-4,5-dihydro-3H-pyridazine-3-carbaldehyde |
| SMILES | COc1ccc(C2=NN(Cc3ccc(N)cc3)C(C=O)CC2)cc1OC1CCCC1 |
| InChI | InChI=1S/C24H29N3O3/c1-29-23-13-8-18(14-24(23)30-21-4-2-3-5-21)22-12-11-20(16-28)27(26-22)15-17-6-9-19(25)10-7-17/h6-10,13-14,16,20-21H,2-5,11-12,15,25H2,1H3 |
| InChIKey | QQTQAQYJNCRRBW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|