C26H31N3O5 — CID 174368697
methyl 4-[amino-[6-(3-cyclopentyloxy-4-methoxyphenyl)-3-formyl-4,5-dihydro-3H-pyridazin-2-yl]methyl]benzoate (PubChem CID 174368697) has the molecular formula C26H31N3O5 and a molecular weight of 465.55 g/mol. Its IUPAC name is methyl 4-[amino-[6-(3-cyclopentyloxy-4-methoxyphenyl)-3-formyl-4,5-dihydro-3H-pyridazin-2-yl]methyl]benzoate.
| Compound Name | methyl 4-[amino-[6-(3-cyclopentyloxy-4-methoxyphenyl)-3-formyl-4,5-dihydro-3H-pyridazin-2-yl]methyl]benzoate |
|---|---|
| PubChem CID | 174368697 |
| Molecular Formula | C26H31N3O5 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | methyl 4-[amino-[6-(3-cyclopentyloxy-4-methoxyphenyl)-3-formyl-4,5-dihydro-3H-pyridazin-2-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(C(N)N2N=C(c3ccc(OC)c(OC4CCCC4)c3)CCC2C=O)cc1 |
| InChI | InChI=1S/C26H31N3O5/c1-32-23-14-11-19(15-24(23)34-21-5-3-4-6-21)22-13-12-20(16-30)29(28-22)25(27)17-7-9-18(10-8-17)26(31)33-2/h7-11,14-16,20-21,25H,3-6,12-13,27H2,1-2H3 |
| InChIKey | CHNJHPINCPJEQT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|