C12H27N3 — CID 174381247
2-butyl-N,N-diethylpiperazin-1-amine (PubChem CID 174381247) has the molecular formula C12H27N3 and a molecular weight of 213.37 g/mol. Its IUPAC name is 2-butyl-N,N-diethylpiperazin-1-amine.
| Compound Name | 2-butyl-N,N-diethylpiperazin-1-amine |
|---|---|
| PubChem CID | 174381247 |
| Molecular Formula | C12H27N3 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.22 |
| IUPAC Name | 2-butyl-N,N-diethylpiperazin-1-amine |
| SMILES | CCCCC1CNCCN1N(CC)CC |
| InChI | InChI=1S/C12H27N3/c1-4-7-8-12-11-13-9-10-15(12)14(5-2)6-3/h12-13H,4-11H2,1-3H3 |
| InChIKey | LVBKFMBPWRUJIP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |