C10H23N3 — CID 174432887
N,N,2-triethylpiperazin-1-amine (PubChem CID 174432887) has the molecular formula C10H23N3 and a molecular weight of 185.31 g/mol. Its IUPAC name is N,N,2-triethylpiperazin-1-amine.
| Compound Name | N,N,2-triethylpiperazin-1-amine |
|---|---|
| PubChem CID | 174432887 |
| Molecular Formula | C10H23N3 |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.19 |
| IUPAC Name | N,N,2-triethylpiperazin-1-amine |
| SMILES | CCC1CNCCN1N(CC)CC |
| InChI | InChI=1S/C10H23N3/c1-4-10-9-11-7-8-13(10)12(5-2)6-3/h10-11H,4-9H2,1-3H3 |
| InChIKey | DICVKTYPRVQBFB-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |