C10H15N3O3 — CID 174382025
N,N-bis(methoxyamino)-2-phenylacetamide (PubChem CID 174382025) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is N,N-bis(methoxyamino)-2-phenylacetamide.
| Compound Name | N,N-bis(methoxyamino)-2-phenylacetamide |
|---|---|
| PubChem CID | 174382025 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | N,N-bis(methoxyamino)-2-phenylacetamide |
| SMILES | CONN(NOC)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C10H15N3O3/c1-15-11-13(12-16-2)10(14)8-9-6-4-3-5-7-9/h3-7,11-12H,8H2,1-2H3 |
| InChIKey | ROWXAEJXMHFMRO-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|