C16H15BrN2O — CID 174382669
4-benzyl-6-bromo-2,3-dihydro-1H-quinoxaline-2-carbaldehyde (PubChem CID 174382669) has the molecular formula C16H15BrN2O and a molecular weight of 331.21 g/mol. Its IUPAC name is 4-benzyl-6-bromo-2,3-dihydro-1H-quinoxaline-2-carbaldehyde.
| Compound Name | 4-benzyl-6-bromo-2,3-dihydro-1H-quinoxaline-2-carbaldehyde |
|---|---|
| PubChem CID | 174382669 |
| Molecular Formula | C16H15BrN2O |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 4-benzyl-6-bromo-2,3-dihydro-1H-quinoxaline-2-carbaldehyde |
| SMILES | O=CC1CN(Cc2ccccc2)c2cc(Br)ccc2N1 |
| InChI | InChI=1S/C16H15BrN2O/c17-13-6-7-15-16(8-13)19(10-14(11-20)18-15)9-12-4-2-1-3-5-12/h1-8,11,14,18H,9-10H2 |
| InChIKey | GHUYDWYXLZLTCM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|