C31H32N2O5S2 — CID 174383203
1,5-bis(6-methyl-3-pyridinyl)-1,5-bis(4-methylsulfonylphenyl)pentan-3-one (PubChem CID 174383203) has the molecular formula C31H32N2O5S2 and a molecular weight of 576.74 g/mol. Its IUPAC name is 1,5-bis(6-methyl-3-pyridinyl)-1,5-bis(4-methylsulfonylphenyl)pentan-3-one.
| Compound Name | 1,5-bis(6-methyl-3-pyridinyl)-1,5-bis(4-methylsulfonylphenyl)pentan-3-one |
|---|---|
| PubChem CID | 174383203 |
| Molecular Formula | C31H32N2O5S2 |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | 1,5-bis(6-methyl-3-pyridinyl)-1,5-bis(4-methylsulfonylphenyl)pentan-3-one |
| SMILES | Cc1ccc(C(CC(=O)CC(c2ccc(S(C)(=O)=O)cc2)c2ccc(C)nc2)c2ccc(S(C)(=O)=O)cc2)cn1 |
| InChI | InChI=1S/C31H32N2O5S2/c1-21-5-7-25(19-32-21)30(23-9-13-28(14-10-23)39(3,35)36)17-27(34)18-31(26-8-6-22(2)33-20-26)24-11-15-29(16-12-24)40(4,37)38/h5-16,19-20,30-31H,17-18H2,1-4H3 |
| InChIKey | MHFBCJSSSILGAM-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 111.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |