About 1-chloro-2-cyclohexylbenzene;pentan-3-one
1-chloro-2-cyclohexylbenzene;pentan-3-one (PubChem CID 174383275) has the molecular formula C17H25ClO
and a molecular weight of 280.84 g/mol. Its IUPAC name is 1-chloro-2-cyclohexylbenzene;pentan-3-one.
Molecular Properties
| Compound Name | 1-chloro-2-cyclohexylbenzene;pentan-3-one |
| PubChem CID | 174383275 |
| Molecular Formula | C17H25ClO |
| Molecular Weight | 280.84 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 1-chloro-2-cyclohexylbenzene;pentan-3-one |
| SMILES | CCC(=O)CC.Clc1ccccc1C1CCCCC1 |
| InChI | InChI=1S/C12H15Cl.C5H10O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-3-5(6)4-2/h4-5,8-10H,1-3,6-7H2;3-4H2,1-2H3 |
| InChIKey | DNWLOHLDKBNEFD-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.84 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-chloro-2-cyclohexylbenzene;pentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-cyclohexylbenzene;pentan-3-one?
The IUPAC name of 1-chloro-2-cyclohexylbenzene;pentan-3-one (CID 174383275) is 1-chloro-2-cyclohexylbenzene;pentan-3-one.
What is the SMILES notation for 1-chloro-2-cyclohexylbenzene;pentan-3-one?
The canonical SMILES for 1-chloro-2-cyclohexylbenzene;pentan-3-one is CCC(=O)CC.Clc1ccccc1C1CCCCC1.
What is the InChIKey of 1-chloro-2-cyclohexylbenzene;pentan-3-one?
The InChIKey is DNWLOHLDKBNEFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Cl.C5H10O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-3-5(6)4-2/h4-5,8-10H,1-3,6-7H2;3-4H2,1-2H3.
What are the key properties of 1-chloro-2-cyclohexylbenzene;pentan-3-one?
1-chloro-2-cyclohexylbenzene;pentan-3-one has a molecular weight of 280.84 g/mol, XLogP of 5.76, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-cyclohexylbenzene;pentan-3-one is sourced from PubChem (CID 174383275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).