C18H17FN2O4 — CID 174385446
(E)-but-2-enedioic acid;4-(7-fluoronaphthalen-2-yl)-1-methyl-4,5-dihydroimidazole (PubChem CID 174385446) has the molecular formula C18H17FN2O4 and a molecular weight of 344.34 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;4-(7-fluoronaphthalen-2-yl)-1-methyl-4,5-dihydroimidazole.
| Compound Name | (E)-but-2-enedioic acid;4-(7-fluoronaphthalen-2-yl)-1-methyl-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 174385446 |
| Molecular Formula | C18H17FN2O4 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | (E)-but-2-enedioic acid;4-(7-fluoronaphthalen-2-yl)-1-methyl-4,5-dihydroimidazole |
| SMILES | CN1C=NC(c2ccc3ccc(F)cc3c2)C1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C14H13FN2.C4H4O4/c1-17-8-14(16-9-17)11-3-2-10-4-5-13(15)7-12(10)6-11;5-3(6)1-2-4(7)8/h2-7,9,14H,8H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | KKNZPWOKGJNAAD-WLHGVMLRSA-N |
| XLogP | 2.71 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|