C21H35N3O3 — CID 174387230
(2S,3S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]-hexylamino]-3-methylpentanamide (PubChem CID 174387230) has the molecular formula C21H35N3O3 and a molecular weight of 377.53 g/mol. Its IUPAC name is (2S,3S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]-hexylamino]-3-methylpentanamide.
| Compound Name | (2S,3S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]-hexylamino]-3-methylpentanamide |
|---|---|
| PubChem CID | 174387230 |
| Molecular Formula | C21H35N3O3 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | (2S,3S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]-hexylamino]-3-methylpentanamide |
| SMILES | CCCCCCN(C(=O)[C@@H](N)Cc1ccc(O)cc1)[C@H](C(N)=O)[C@@H](C)CC |
| InChI | InChI=1S/C21H35N3O3/c1-4-6-7-8-13-24(19(20(23)26)15(3)5-2)21(27)18(22)14-16-9-11-17(25)12-10-16/h9-12,15,18-19,25H,4-8,13-14,22H2,1-3H3,(H2,23,26)/t15-,18-,19-/m0/s1 |
| InChIKey | AZYYPZVABQZXTM-SNRMKQJTSA-N |
| XLogP | 2.57 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|