C23H32O7 — CID 174389139
(8S,9S,10R,13S,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-1-(2-hydroxyethoxy)-10,13-dimethyl-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,11-dione (PubChem CID 174389139) has the molecular formula C23H32O7 and a molecular weight of 420.50 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-1-(2-hydroxyethoxy)-10,13-dimethyl-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,11-dione.
| Compound Name | (8S,9S,10R,13S,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-1-(2-hydroxyethoxy)-10,13-dimethyl-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,11-dione |
|---|---|
| PubChem CID | 174389139 |
| Molecular Formula | C23H32O7 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | (8S,9S,10R,13S,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-1-(2-hydroxyethoxy)-10,13-dimethyl-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,11-dione |
| SMILES | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(=O)CC(OCCO)[C@@]43C)[C@@H]1CC[C@]2(O)C(=O)CO |
| InChI | InChI=1S/C23H32O7/c1-21-11-17(27)20-15(16(21)5-6-23(21,29)18(28)12-25)4-3-13-9-14(26)10-19(22(13,20)2)30-8-7-24/h9,15-16,19-20,24-25,29H,3-8,10-12H2,1-2H3/t15-,16-,19?,20+,21-,22+,23-/m0/s1 |
| InChIKey | JSXFSDHOIWHRRM-ZIJFCRNMSA-N |
| XLogP | 0.98 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'steroid_A(2)', 'substructure': 'N/A'} |
|---|