C20H32N2O4 — CID 174389448
4-(2-aminoethyl)-2-[methyl-(2-octoxyacetyl)amino]benzoic acid (PubChem CID 174389448) has the molecular formula C20H32N2O4 and a molecular weight of 364.49 g/mol. Its IUPAC name is 4-(2-aminoethyl)-2-[methyl-(2-octoxyacetyl)amino]benzoic acid.
| Compound Name | 4-(2-aminoethyl)-2-[methyl-(2-octoxyacetyl)amino]benzoic acid |
|---|---|
| PubChem CID | 174389448 |
| Molecular Formula | C20H32N2O4 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 4-(2-aminoethyl)-2-[methyl-(2-octoxyacetyl)amino]benzoic acid |
| SMILES | CCCCCCCCOCC(=O)N(C)c1cc(CCN)ccc1C(=O)O |
| InChI | InChI=1S/C20H32N2O4/c1-3-4-5-6-7-8-13-26-15-19(23)22(2)18-14-16(11-12-21)9-10-17(18)20(24)25/h9-10,14H,3-8,11-13,15,21H2,1-2H3,(H,24,25) |
| InChIKey | YQFRPIUOCWIBHP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|